C10H21NO2S — CID 87477260
tert-butyl N-[(2R)-3-methyl-1-sulfanylbutan-2-yl]carbamate (PubChem CID 87477260) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-methyl-1-sulfanylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-methyl-1-sulfanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 87477260 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | tert-butyl N-[(2R)-3-methyl-1-sulfanylbutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21NO2S/c1-7(2)8(6-14)11-9(12)13-10(3,4)5/h7-8,14H,6H2,1-5H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | KEEHNMXCFHWZHT-QMMMGPOBSA-N |
| XLogP | 2.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|