C20H40N2O4Se2 — CID 139264879
tert-butyl N-[(2R)-3-methyl-1-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]diselanyl]butan-2-yl]carbamate (PubChem CID 139264879) has the molecular formula C20H40N2O4Se2 and a molecular weight of 530.47 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-methyl-1-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]diselanyl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-methyl-1-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]diselanyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 139264879 |
| Molecular Formula | C20H40N2O4Se2 |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | tert-butyl N-[(2R)-3-methyl-1-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]diselanyl]butan-2-yl]carbamate |
| SMILES | CC(C)[C@H](C[Se][Se]C[C@@H](NC(=O)OC(C)(C)C)C(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H40N2O4Se2/c1-13(2)15(21-17(23)25-19(5,6)7)11-27-28-12-16(14(3)4)22-18(24)26-20(8,9)10/h13-16H,11-12H2,1-10H3,(H,21,23)(H,22,24)/t15-,16+ |
| InChIKey | QVKXQRLIKBIMNF-IYBDPMFKSA-N |
| XLogP | 4.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|