C10H20INO2 — CID 11141505
tert-butyl N-[(2S)-1-iodo-3-methylbutan-2-yl]carbamate (PubChem CID 11141505) has the molecular formula C10H20INO2 and a molecular weight of 313.18 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-iodo-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-iodo-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 11141505 |
| Molecular Formula | C10H20INO2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | tert-butyl N-[(2S)-1-iodo-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](CI)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20INO2/c1-7(2)8(6-11)12-9(13)14-10(3,4)5/h7-8H,6H2,1-5H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | XBOPXPWVPIOUTD-MRVPVSSYSA-N |
| XLogP | 2.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|