C12H22BrNO3 — CID 170910641
tert-butyl N-[(3R)-6-bromo-2-methyl-5-oxohexan-3-yl]carbamate (PubChem CID 170910641) has the molecular formula C12H22BrNO3 and a molecular weight of 308.22 g/mol. Its IUPAC name is tert-butyl N-[(3R)-6-bromo-2-methyl-5-oxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-6-bromo-2-methyl-5-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 170910641 |
| Molecular Formula | C12H22BrNO3 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | tert-butyl N-[(3R)-6-bromo-2-methyl-5-oxohexan-3-yl]carbamate |
| SMILES | CC(C)[C@@H](CC(=O)CBr)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22BrNO3/c1-8(2)10(6-9(15)7-13)14-11(16)17-12(3,4)5/h8,10H,6-7H2,1-5H3,(H,14,16)/t10-/m1/s1 |
| InChIKey | GVDURGKREZQCEE-SNVBAGLBSA-N |
| XLogP | 2.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|