C11H20N2O2 — CID 85303813
tert-butyl N-(1-cyano-3-methylbutan-2-yl)carbamate (PubChem CID 85303813) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is tert-butyl N-(1-cyano-3-methylbutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-cyano-3-methylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 85303813 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | tert-butyl N-(1-cyano-3-methylbutan-2-yl)carbamate |
| SMILES | CC(C)C(CC#N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20N2O2/c1-8(2)9(6-7-12)13-10(14)15-11(3,4)5/h8-9H,6H2,1-5H3,(H,13,14) |
| InChIKey | KNWHKVBSGNXETQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |