C12H22N2O2 — CID 14925138
tert-butyl N-(1-cyano-4-methylpentan-2-yl)carbamate (PubChem CID 14925138) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is tert-butyl N-(1-cyano-4-methylpentan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-cyano-4-methylpentan-2-yl)carbamate |
|---|---|
| PubChem CID | 14925138 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | tert-butyl N-(1-cyano-4-methylpentan-2-yl)carbamate |
| SMILES | CC(C)CC(CC#N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O2/c1-9(2)8-10(6-7-13)14-11(15)16-12(3,4)5/h9-10H,6,8H2,1-5H3,(H,14,15) |
| InChIKey | MBYHFWNDSROMGX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |