C11H23NO4 — CID 23598208
tert-butyl N-(1-hydroperoxy-4-methylpentan-2-yl)carbamate (PubChem CID 23598208) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is tert-butyl N-(1-hydroperoxy-4-methylpentan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-hydroperoxy-4-methylpentan-2-yl)carbamate |
|---|---|
| PubChem CID | 23598208 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | tert-butyl N-(1-hydroperoxy-4-methylpentan-2-yl)carbamate |
| SMILES | CC(C)CC(COO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23NO4/c1-8(2)6-9(7-15-14)12-10(13)16-11(3,4)5/h8-9,14H,6-7H2,1-5H3,(H,12,13) |
| InChIKey | RQZWMUJVJYGCJC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|