C12H20N2O4 — CID 10515230
tert-butyl N-[(2S,3S,4R)-1-cyano-3,4-dihydroxyhex-5-en-2-yl]carbamate (PubChem CID 10515230) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,4R)-1-cyano-3,4-dihydroxyhex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,4R)-1-cyano-3,4-dihydroxyhex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 10515230 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | tert-butyl N-[(2S,3S,4R)-1-cyano-3,4-dihydroxyhex-5-en-2-yl]carbamate |
| SMILES | C=C[C@@H](O)[C@@H](O)[C@H](CC#N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20N2O4/c1-5-9(15)10(16)8(6-7-13)14-11(17)18-12(2,3)4/h5,8-10,15-16H,1,6H2,2-4H3,(H,14,17)/t8-,9+,10-/m0/s1 |
| InChIKey | OGFWAKXWJWNWNR-AEJSXWLSSA-N |
| XLogP | 0.70 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|