C12H23NO3 — CID 11322160
tert-butyl N-[(3S)-4-hydroxy-2-methylhex-5-en-3-yl]carbamate (PubChem CID 11322160) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl N-[(3S)-4-hydroxy-2-methylhex-5-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-4-hydroxy-2-methylhex-5-en-3-yl]carbamate |
|---|---|
| PubChem CID | 11322160 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | tert-butyl N-[(3S)-4-hydroxy-2-methylhex-5-en-3-yl]carbamate |
| SMILES | C=CC(O)[C@@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C12H23NO3/c1-7-9(14)10(8(2)3)13-11(15)16-12(4,5)6/h7-10,14H,1H2,2-6H3,(H,13,15)/t9?,10-/m0/s1 |
| InChIKey | PUJZPMGNMZHBAB-AXDSSHIGSA-N |
| XLogP | 2.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|