C13H24BrNO3 — CID 23243726
tert-butyl N-[(3S,4R,5S)-5-bromo-3-hydroxyoct-1-en-4-yl]carbamate (PubChem CID 23243726) has the molecular formula C13H24BrNO3 and a molecular weight of 322.24 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R,5S)-5-bromo-3-hydroxyoct-1-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R,5S)-5-bromo-3-hydroxyoct-1-en-4-yl]carbamate |
|---|---|
| PubChem CID | 23243726 |
| Molecular Formula | C13H24BrNO3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | tert-butyl N-[(3S,4R,5S)-5-bromo-3-hydroxyoct-1-en-4-yl]carbamate |
| SMILES | C=C[C@H](O)[C@@H](NC(=O)OC(C)(C)C)[C@@H](Br)CCC |
| InChI | InChI=1S/C13H24BrNO3/c1-6-8-9(14)11(10(16)7-2)15-12(17)18-13(3,4)5/h7,9-11,16H,2,6,8H2,1,3-5H3,(H,15,17)/t9-,10-,11-/m0/s1 |
| InChIKey | KYLLVWXYDVMKAX-DCAQKATOSA-N |
| XLogP | 2.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|