C11H23NO3 — CID 87514848
tert-butyl N-[(2S)-3-hydroxyhexan-2-yl]carbamate (PubChem CID 87514848) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-hydroxyhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-hydroxyhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 87514848 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | tert-butyl N-[(2S)-3-hydroxyhexan-2-yl]carbamate |
| SMILES | CCCC(O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23NO3/c1-6-7-9(13)8(2)12-10(14)15-11(3,4)5/h8-9,13H,6-7H2,1-5H3,(H,12,14)/t8-,9?/m0/s1 |
| InChIKey | WXHWPTOADMDLTA-IENPIDJESA-N |
| XLogP | 2.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |