C11H21NO4S — CID 85393804
S-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] ethanethioate (PubChem CID 85393804) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is S-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] ethanethioate.
| Compound Name | S-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] ethanethioate |
|---|---|
| PubChem CID | 85393804 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | S-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO4S/c1-7(9(14)6-17-8(2)13)12-10(15)16-11(3,4)5/h7,9,14H,6H2,1-5H3,(H,12,15) |
| InChIKey | ZNHKONBADJDNEK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|