C9H18INO2S — CID 130294561
tert-butyl N-[(2R)-1-(iodomethylsulfanyl)propan-2-yl]carbamate (PubChem CID 130294561) has the molecular formula C9H18INO2S and a molecular weight of 331.22 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(iodomethylsulfanyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(iodomethylsulfanyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 130294561 |
| Molecular Formula | C9H18INO2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | tert-butyl N-[(2R)-1-(iodomethylsulfanyl)propan-2-yl]carbamate |
| SMILES | C[C@H](CSCI)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18INO2S/c1-7(5-14-6-10)11-8(12)13-9(2,3)4/h7H,5-6H2,1-4H3,(H,11,12)/t7-/m1/s1 |
| InChIKey | NUMSBSZPPJJZHW-SSDOTTSWSA-N |
| XLogP | 3.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|