C14H25NO3S — CID 134567525
S-[(E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-3-enyl] ethanethioate (PubChem CID 134567525) has the molecular formula C14H25NO3S and a molecular weight of 287.43 g/mol. Its IUPAC name is S-[(E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-3-enyl] ethanethioate.
| Compound Name | S-[(E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 134567525 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | S-[(E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-3-enyl] ethanethioate |
| SMILES | CCC/C=C/[C@@H](CSC(C)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO3S/c1-6-7-8-9-12(10-19-11(2)16)15-13(17)18-14(3,4)5/h8-9,12H,6-7,10H2,1-5H3,(H,15,17)/b9-8+/t12-/m0/s1 |
| InChIKey | NBUKTAVYHYDLCO-BCPZQOPPSA-N |
| XLogP | 3.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|