C22H39NO7S — CID 10322075
ditert-butyl 2-[4-acetylsulfanyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]propanedioate (PubChem CID 10322075) has the molecular formula C22H39NO7S and a molecular weight of 461.62 g/mol. Its IUPAC name is ditert-butyl 2-[4-acetylsulfanyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]propanedioate.
| Compound Name | ditert-butyl 2-[4-acetylsulfanyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]propanedioate |
|---|---|
| PubChem CID | 10322075 |
| Molecular Formula | C22H39NO7S |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | ditert-butyl 2-[4-acetylsulfanyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]propanedioate |
| SMILES | CC(=O)SCC(CCC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H39NO7S/c1-14(24)31-13-15(23-19(27)30-22(8,9)10)11-12-16(17(25)28-20(2,3)4)18(26)29-21(5,6)7/h15-16H,11-13H2,1-10H3,(H,23,27) |
| InChIKey | IFJQNCCUHNHWQR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|