C13H25NO3S2 — CID 123663296
S-[4-ethylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] ethanethioate (PubChem CID 123663296) has the molecular formula C13H25NO3S2 and a molecular weight of 307.48 g/mol. Its IUPAC name is S-[4-ethylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] ethanethioate.
| Compound Name | S-[4-ethylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] ethanethioate |
|---|---|
| PubChem CID | 123663296 |
| Molecular Formula | C13H25NO3S2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | S-[4-ethylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] ethanethioate |
| SMILES | CCSCCC(CSC(C)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO3S2/c1-6-18-8-7-11(9-19-10(2)15)14-12(16)17-13(3,4)5/h11H,6-9H2,1-5H3,(H,14,16) |
| InChIKey | RZTPUISLWZDPRI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|