C11H21NO5S — CID 126762335
(3R)-4-ethylsulfanyl-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 126762335) has the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. Its IUPAC name is (3R)-4-ethylsulfanyl-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (3R)-4-ethylsulfanyl-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 126762335 |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (3R)-4-ethylsulfanyl-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CCSC[C@H](NC(=O)OC(C)(C)C)C(O)C(=O)O |
| InChI | InChI=1S/C11H21NO5S/c1-5-18-6-7(8(13)9(14)15)12-10(16)17-11(2,3)4/h7-8,13H,5-6H2,1-4H3,(H,12,16)(H,14,15)/t7-,8?/m0/s1 |
| InChIKey | SJHAIZRGEDINLH-JAMMHHFISA-N |
| XLogP | 1.08 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |