C10H20N2O4 — CID 143352872
tert-butyl N-(1-amino-2-hydroxy-1-oxopentan-3-yl)carbamate (PubChem CID 143352872) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is tert-butyl N-(1-amino-2-hydroxy-1-oxopentan-3-yl)carbamate.
| Compound Name | tert-butyl N-(1-amino-2-hydroxy-1-oxopentan-3-yl)carbamate |
|---|---|
| PubChem CID | 143352872 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | tert-butyl N-(1-amino-2-hydroxy-1-oxopentan-3-yl)carbamate |
| SMILES | CCC(NC(=O)OC(C)(C)C)C(O)C(N)=O |
| InChI | InChI=1S/C10H20N2O4/c1-5-6(7(13)8(11)14)12-9(15)16-10(2,3)4/h6-7,13H,5H2,1-4H3,(H2,11,14)(H,12,15) |
| InChIKey | KGVLPUOWIHWOIY-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |