C8H18N2O2 — CID 45092381
tert-butyl N-[(1R)-1-aminopropyl]carbamate (PubChem CID 45092381) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-aminopropyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-aminopropyl]carbamate |
|---|---|
| PubChem CID | 45092381 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | tert-butyl N-[(1R)-1-aminopropyl]carbamate |
| SMILES | CC[C@H](N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H18N2O2/c1-5-6(9)10-7(11)12-8(2,3)4/h6H,5,9H2,1-4H3,(H,10,11)/t6-/m1/s1 |
| InChIKey | WUUZQZURHHSYSF-ZCFIWIBFSA-N |
| XLogP | 1.21 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|