C7H17N3O2 — CID 95800069
tert-butyl N-[(1S)-1,2-diaminoethyl]carbamate (PubChem CID 95800069) has the molecular formula C7H17N3O2 and a molecular weight of 175.23 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1,2-diaminoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1,2-diaminoethyl]carbamate |
|---|---|
| PubChem CID | 95800069 |
| Molecular Formula | C7H17N3O2 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.13 |
| IUPAC Name | tert-butyl N-[(1S)-1,2-diaminoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](N)CN |
| InChI | InChI=1S/C7H17N3O2/c1-7(2,3)12-6(11)10-5(9)4-8/h5H,4,8-9H2,1-3H3,(H,10,11)/t5-/m0/s1 |
| InChIKey | UCTVDNQXJGVARC-YFKPBYRVSA-N |
| XLogP | -0.25 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|