C14H30N2O4 — CID 143350674
tert-butyl N-(2-hydroxy-5-methylheptan-3-yl)carbamate;formamide (PubChem CID 143350674) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxy-5-methylheptan-3-yl)carbamate;formamide.
| Compound Name | tert-butyl N-(2-hydroxy-5-methylheptan-3-yl)carbamate;formamide |
|---|---|
| PubChem CID | 143350674 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | tert-butyl N-(2-hydroxy-5-methylheptan-3-yl)carbamate;formamide |
| SMILES | CCC(C)CC(NC(=O)OC(C)(C)C)C(C)O.NC=O |
| InChI | InChI=1S/C13H27NO3.CH3NO/c1-7-9(2)8-11(10(3)15)14-12(16)17-13(4,5)6;2-1-3/h9-11,15H,7-8H2,1-6H3,(H,14,16);1H,(H2,2,3) |
| InChIKey | WAMOFOHPTRESQA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|