C10H18F3NO3 — CID 171802376
tert-butyl N-(1,1,1-trifluoro-4-hydroxypentan-3-yl)carbamate (PubChem CID 171802376) has the molecular formula C10H18F3NO3 and a molecular weight of 257.25 g/mol. Its IUPAC name is tert-butyl N-(1,1,1-trifluoro-4-hydroxypentan-3-yl)carbamate.
| Compound Name | tert-butyl N-(1,1,1-trifluoro-4-hydroxypentan-3-yl)carbamate |
|---|---|
| PubChem CID | 171802376 |
| Molecular Formula | C10H18F3NO3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | tert-butyl N-(1,1,1-trifluoro-4-hydroxypentan-3-yl)carbamate |
| SMILES | CC(O)C(CC(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18F3NO3/c1-6(15)7(5-10(11,12)13)14-8(16)17-9(2,3)4/h6-7,15H,5H2,1-4H3,(H,14,16) |
| InChIKey | BEBBLIMKUVKKIA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |