C14H23F3N2O4 — CID 21258897
tert-butyl N-[5-(tert-butylamino)-1,1,1-trifluoro-4,5-dioxopentan-3-yl]carbamate (PubChem CID 21258897) has the molecular formula C14H23F3N2O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is tert-butyl N-[5-(tert-butylamino)-1,1,1-trifluoro-4,5-dioxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-(tert-butylamino)-1,1,1-trifluoro-4,5-dioxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 21258897 |
| Molecular Formula | C14H23F3N2O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | tert-butyl N-[5-(tert-butylamino)-1,1,1-trifluoro-4,5-dioxopentan-3-yl]carbamate |
| SMILES | CC(C)(C)NC(=O)C(=O)C(CC(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23F3N2O4/c1-12(2,3)19-10(21)9(20)8(7-14(15,16)17)18-11(22)23-13(4,5)6/h8H,7H2,1-6H3,(H,18,22)(H,19,21) |
| InChIKey | HZFKTDOGXRHHQS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|