C12H20Br2FNO3 — CID 130185110
tert-butyl N-[(3S)-1,1-dibromo-5-fluoro-5-methyl-2-oxohexan-3-yl]carbamate (PubChem CID 130185110) has the molecular formula C12H20Br2FNO3 and a molecular weight of 405.10 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1,1-dibromo-5-fluoro-5-methyl-2-oxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1,1-dibromo-5-fluoro-5-methyl-2-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 130185110 |
| Molecular Formula | C12H20Br2FNO3 |
| Molecular Weight | 405.10 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | tert-butyl N-[(3S)-1,1-dibromo-5-fluoro-5-methyl-2-oxohexan-3-yl]carbamate |
| SMILES | CC(C)(F)C[C@H](NC(=O)OC(C)(C)C)C(=O)C(Br)Br |
| InChI | InChI=1S/C12H20Br2FNO3/c1-11(2,3)19-10(18)16-7(6-12(4,5)15)8(17)9(13)14/h7,9H,6H2,1-5H3,(H,16,18)/t7-/m0/s1 |
| InChIKey | CFKXKASZWUCOIX-ZETCQYMHSA-N |
| XLogP | 3.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.10 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|