C15H31IN2O3S — CID 158703324
[4-(tert-butylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium iodide (PubChem CID 158703324) has the molecular formula C15H31IN2O3S and a molecular weight of 446.40 g/mol. Its IUPAC name is [4-(tert-butylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium iodide.
| Compound Name | [4-(tert-butylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium iodide |
|---|---|
| PubChem CID | 158703324 |
| Molecular Formula | C15H31IN2O3S |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | [4-(tert-butylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium iodide |
| SMILES | C[S+](C)CCC(NC(=O)OC(C)(C)C)C(=O)NC(C)(C)C.[I-] |
| InChI | InChI=1S/C15H30N2O3S.HI/c1-14(2,3)17-12(18)11(9-10-21(7)8)16-13(19)20-15(4,5)6;/h11H,9-10H2,1-8H3,(H-,16,17,18,19);1H |
| InChIKey | IHUWFGOXESVKIX-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|