C12H24N2O4 — CID 169302219
tert-butyl N-[(2S)-4-hydroxy-1-oxo-1-(propan-2-ylamino)butan-2-yl]carbamate (PubChem CID 169302219) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-hydroxy-1-oxo-1-(propan-2-ylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-hydroxy-1-oxo-1-(propan-2-ylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 169302219 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | tert-butyl N-[(2S)-4-hydroxy-1-oxo-1-(propan-2-ylamino)butan-2-yl]carbamate |
| SMILES | CC(C)NC(=O)[C@H](CCO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24N2O4/c1-8(2)13-10(16)9(6-7-15)14-11(17)18-12(3,4)5/h8-9,15H,6-7H2,1-5H3,(H,13,16)(H,14,17)/t9-/m0/s1 |
| InChIKey | SERRPDWAQSMUPM-VIFPVBQESA-N |
| XLogP | 0.79 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |