C11H22N2O5 — CID 10858271
tert-butyl N-[(2S)-4-hydroxy-1-[methoxy(methyl)amino]-1-oxobutan-2-yl]carbamate (PubChem CID 10858271) has the molecular formula C11H22N2O5 and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-hydroxy-1-[methoxy(methyl)amino]-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-hydroxy-1-[methoxy(methyl)amino]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10858271 |
| Molecular Formula | C11H22N2O5 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | tert-butyl N-[(2S)-4-hydroxy-1-[methoxy(methyl)amino]-1-oxobutan-2-yl]carbamate |
| SMILES | CON(C)C(=O)[C@H](CCO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N2O5/c1-11(2,3)18-10(16)12-8(6-7-14)9(15)13(4)17-5/h8,14H,6-7H2,1-5H3,(H,12,16)/t8-/m0/s1 |
| InChIKey | HELDTSIKEWFFOL-QMMMGPOBSA-N |
| XLogP | 0.28 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|