C12H24N2O4S — CID 85145706
tert-butyl N-[1-(2-hydroxyethylamino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 85145706) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is tert-butyl N-[1-(2-hydroxyethylamino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-hydroxyethylamino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 85145706 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | tert-butyl N-[1-(2-hydroxyethylamino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CSCCC(NC(=O)OC(C)(C)C)C(=O)NCCO |
| InChI | InChI=1S/C12H24N2O4S/c1-12(2,3)18-11(17)14-9(5-8-19-4)10(16)13-6-7-15/h9,15H,5-8H2,1-4H3,(H,13,16)(H,14,17) |
| InChIKey | NRQMVSDCHJCULS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |