C15H31N2O6PS — CID 72747858
tert-butyl N-[1-(diethoxyphosphorylmethylamino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 72747858) has the molecular formula C15H31N2O6PS and a molecular weight of 398.46 g/mol. Its IUPAC name is tert-butyl N-[1-(diethoxyphosphorylmethylamino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(diethoxyphosphorylmethylamino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 72747858 |
| Molecular Formula | C15H31N2O6PS |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | tert-butyl N-[1-(diethoxyphosphorylmethylamino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCOP(=O)(CNC(=O)C(CCSC)NC(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C15H31N2O6PS/c1-7-21-24(20,22-8-2)11-16-13(18)12(9-10-25-6)17-14(19)23-15(3,4)5/h12H,7-11H2,1-6H3,(H,16,18)(H,17,19) |
| InChIKey | UDPBYCVEELVSJX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|