C12H25N2O6P — CID 134929543
tert-butyl N-[2-(diethoxyphosphorylmethylamino)-2-oxoethyl]carbamate (PubChem CID 134929543) has the molecular formula C12H25N2O6P and a molecular weight of 324.31 g/mol. Its IUPAC name is tert-butyl N-[2-(diethoxyphosphorylmethylamino)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(diethoxyphosphorylmethylamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 134929543 |
| Molecular Formula | C12H25N2O6P |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl N-[2-(diethoxyphosphorylmethylamino)-2-oxoethyl]carbamate |
| SMILES | CCOP(=O)(CNC(=O)CNC(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C12H25N2O6P/c1-6-18-21(17,19-7-2)9-14-10(15)8-13-11(16)20-12(3,4)5/h6-9H2,1-5H3,(H,13,16)(H,14,15) |
| InChIKey | WQMPUPJBCHCBKF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|