C10H20N2O5 — CID 167104195
tert-butyl N-[2-(2,2-dihydroxypropylamino)-2-oxoethyl]carbamate (PubChem CID 167104195) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is tert-butyl N-[2-(2,2-dihydroxypropylamino)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,2-dihydroxypropylamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 167104195 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | tert-butyl N-[2-(2,2-dihydroxypropylamino)-2-oxoethyl]carbamate |
| SMILES | CC(O)(O)CNC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20N2O5/c1-9(2,3)17-8(14)11-5-7(13)12-6-10(4,15)16/h15-16H,5-6H2,1-4H3,(H,11,14)(H,12,13) |
| InChIKey | SKRHIHWFFAUTGD-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|