C15H28N2O5 — CID 154932329
tert-butyl 4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]butanoate (PubChem CID 154932329) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl 4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]butanoate.
| Compound Name | tert-butyl 4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 154932329 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | tert-butyl 4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O5/c1-14(2,3)21-12(19)8-7-9-16-11(18)10-17-13(20)22-15(4,5)6/h7-10H2,1-6H3,(H,16,18)(H,17,20) |
| InChIKey | HRQAPAISNKJNME-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|