C12H22ClN3O4 — CID 108570337
tert-butyl N-[2-[2-(3-chloropropanoylamino)ethylamino]-2-oxoethyl]carbamate (PubChem CID 108570337) has the molecular formula C12H22ClN3O4 and a molecular weight of 307.78 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(3-chloropropanoylamino)ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(3-chloropropanoylamino)ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108570337 |
| Molecular Formula | C12H22ClN3O4 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | tert-butyl N-[2-[2-(3-chloropropanoylamino)ethylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCNC(=O)CCCl |
| InChI | InChI=1S/C12H22ClN3O4/c1-12(2,3)20-11(19)16-8-10(18)15-7-6-14-9(17)4-5-13/h4-8H2,1-3H3,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | RTSMQHRYHUVPOJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|