C12H22ClN3O5 — CID 108570344
tert-butyl N-[2-[2-(2-chloroethoxycarbonylamino)ethylamino]-2-oxoethyl]carbamate (PubChem CID 108570344) has the molecular formula C12H22ClN3O5 and a molecular weight of 323.78 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-chloroethoxycarbonylamino)ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-chloroethoxycarbonylamino)ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108570344 |
| Molecular Formula | C12H22ClN3O5 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | tert-butyl N-[2-[2-(2-chloroethoxycarbonylamino)ethylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCNC(=O)OCCCl |
| InChI | InChI=1S/C12H22ClN3O5/c1-12(2,3)21-11(19)16-8-9(17)14-5-6-15-10(18)20-7-4-13/h4-8H2,1-3H3,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | XVKRNKHCCWFRKD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|