C10H19ClN2O3 — CID 108570931
2-chloroethyl N-[2-(3-methylbutanoylamino)ethyl]carbamate (PubChem CID 108570931) has the molecular formula C10H19ClN2O3 and a molecular weight of 250.73 g/mol. Its IUPAC name is 2-chloroethyl N-[2-(3-methylbutanoylamino)ethyl]carbamate.
| Compound Name | 2-chloroethyl N-[2-(3-methylbutanoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 108570931 |
| Molecular Formula | C10H19ClN2O3 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-chloroethyl N-[2-(3-methylbutanoylamino)ethyl]carbamate |
| SMILES | CC(C)CC(=O)NCCNC(=O)OCCCl |
| InChI | InChI=1S/C10H19ClN2O3/c1-8(2)7-9(14)12-4-5-13-10(15)16-6-3-11/h8H,3-7H2,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | GFLVEGZLXUOPGN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|