C11H22N2O2 — CID 108570913
N-[2-(butanoylamino)ethyl]-3-methylbutanamide (PubChem CID 108570913) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N-[2-(butanoylamino)ethyl]-3-methylbutanamide.
| Compound Name | N-[2-(butanoylamino)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 108570913 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N-[2-(butanoylamino)ethyl]-3-methylbutanamide |
| SMILES | CCCC(=O)NCCNC(=O)CC(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-4-5-10(14)12-6-7-13-11(15)8-9(2)3/h9H,4-8H2,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | QHGYDLLRWDTWJO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|