C9H20N2O2 — CID 104593451
N-[2-(2-hydroxypropylamino)ethyl]butanamide (PubChem CID 104593451) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-[2-(2-hydroxypropylamino)ethyl]butanamide.
| Compound Name | N-[2-(2-hydroxypropylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 104593451 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | N-[2-(2-hydroxypropylamino)ethyl]butanamide |
| SMILES | CCCC(=O)NCCNCC(C)O |
| InChI | InChI=1S/C9H20N2O2/c1-3-4-9(13)11-6-5-10-7-8(2)12/h8,10,12H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | NUOXLZYAFUBPRX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|