C8H12ClN3O3 — CID 108570424
2-chloroethyl N-[2-[(2-cyanoacetyl)amino]ethyl]carbamate (PubChem CID 108570424) has the molecular formula C8H12ClN3O3 and a molecular weight of 233.65 g/mol. Its IUPAC name is 2-chloroethyl N-[2-[(2-cyanoacetyl)amino]ethyl]carbamate.
| Compound Name | 2-chloroethyl N-[2-[(2-cyanoacetyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108570424 |
| Molecular Formula | C8H12ClN3O3 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-chloroethyl N-[2-[(2-cyanoacetyl)amino]ethyl]carbamate |
| SMILES | N#CCC(=O)NCCNC(=O)OCCCl |
| InChI | InChI=1S/C8H12ClN3O3/c9-2-6-15-8(14)12-5-4-11-7(13)1-3-10/h1-2,4-6H2,(H,11,13)(H,12,14) |
| InChIKey | PTOXFZGUNHHTEH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|