C15H20Cl2N2O4 — CID 108572526
2-chloroethyl N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]carbamate (PubChem CID 108572526) has the molecular formula C15H20Cl2N2O4 and a molecular weight of 363.24 g/mol. Its IUPAC name is 2-chloroethyl N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]carbamate.
| Compound Name | 2-chloroethyl N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108572526 |
| Molecular Formula | C15H20Cl2N2O4 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-chloroethyl N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]carbamate |
| SMILES | Cc1cc(OCC(=O)NCCNC(=O)OCCCl)cc(C)c1Cl |
| InChI | InChI=1S/C15H20Cl2N2O4/c1-10-7-12(8-11(2)14(10)17)23-9-13(20)18-4-5-19-15(21)22-6-3-16/h7-8H,3-6,9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | HGODBMFAJMSKIO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|