C20H25ClN2O4S — CID 108572497
2-(4-chloro-3,5-dimethylphenoxy)-N-[2-[(3,4-dimethylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 108572497) has the molecular formula C20H25ClN2O4S and a molecular weight of 424.95 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-[2-[(3,4-dimethylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[2-[(3,4-dimethylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 108572497 |
| Molecular Formula | C20H25ClN2O4S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[2-[(3,4-dimethylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)COc2cc(C)c(Cl)c(C)c2)cc1C |
| InChI | InChI=1S/C20H25ClN2O4S/c1-13-5-6-18(11-14(13)2)28(25,26)23-8-7-22-19(24)12-27-17-9-15(3)20(21)16(4)10-17/h5-6,9-11,23H,7-8,12H2,1-4H3,(H,22,24) |
| InChIKey | PJKZDQCQDWMCOC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|