C19H20BrClN2O3 — CID 108539348
4-bromo-N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]benzamide (PubChem CID 108539348) has the molecular formula C19H20BrClN2O3 and a molecular weight of 439.74 g/mol. Its IUPAC name is 4-bromo-N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108539348 |
| Molecular Formula | C19H20BrClN2O3 |
| Molecular Weight | 439.74 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 4-bromo-N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]benzamide |
| SMILES | Cc1cc(OCC(=O)NCCNC(=O)c2ccc(Br)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C19H20BrClN2O3/c1-12-9-16(10-13(2)18(12)21)26-11-17(24)22-7-8-23-19(25)14-3-5-15(20)6-4-14/h3-6,9-10H,7-8,11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | NJTIWABIWMJNAX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.74 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|