C23H24ClN3O3 — CID 108541231
N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-4-pyrrol-1-ylbenzamide (PubChem CID 108541231) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 108541231 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-4-pyrrol-1-ylbenzamide |
| SMILES | Cc1cc(OCC(=O)NCCNC(=O)c2ccc(-n3cccc3)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C23H24ClN3O3/c1-16-13-20(14-17(2)22(16)24)30-15-21(28)25-9-10-26-23(29)18-5-7-19(8-6-18)27-11-3-4-12-27/h3-8,11-14H,9-10,15H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | JRQIBOJQTKPZIO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|