C19H23N3O4 — CID 108573499
ethyl 4-oxo-4-[2-[(4-pyrrol-1-ylbenzoyl)amino]ethylamino]butanoate (PubChem CID 108573499) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl 4-oxo-4-[2-[(4-pyrrol-1-ylbenzoyl)amino]ethylamino]butanoate.
| Compound Name | ethyl 4-oxo-4-[2-[(4-pyrrol-1-ylbenzoyl)amino]ethylamino]butanoate |
|---|---|
| PubChem CID | 108573499 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | ethyl 4-oxo-4-[2-[(4-pyrrol-1-ylbenzoyl)amino]ethylamino]butanoate |
| SMILES | CCOC(=O)CCC(=O)NCCNC(=O)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C19H23N3O4/c1-2-26-18(24)10-9-17(23)20-11-12-21-19(25)15-5-7-16(8-6-15)22-13-3-4-14-22/h3-8,13-14H,2,9-12H2,1H3,(H,20,23)(H,21,25) |
| InChIKey | CPDLDIVNQFQSKV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|