C19H21ClN2O3S — CID 108541230
N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-2-sulfanylbenzamide (PubChem CID 108541230) has the molecular formula C19H21ClN2O3S and a molecular weight of 392.91 g/mol. Its IUPAC name is N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-2-sulfanylbenzamide.
| Compound Name | N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 108541230 |
| Molecular Formula | C19H21ClN2O3S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-2-sulfanylbenzamide |
| SMILES | Cc1cc(OCC(=O)NCCNC(=O)c2ccccc2S)cc(C)c1Cl |
| InChI | InChI=1S/C19H21ClN2O3S/c1-12-9-14(10-13(2)18(12)20)25-11-17(23)21-7-8-22-19(24)15-5-3-4-6-16(15)26/h3-6,9-10,26H,7-8,11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | XMCASTCKAMZDIC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|