C22H25ClN2O3S — CID 108554700
N-[1-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]piperidin-4-yl]-2-sulfanylbenzamide (PubChem CID 108554700) has the molecular formula C22H25ClN2O3S and a molecular weight of 432.97 g/mol. Its IUPAC name is N-[1-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]piperidin-4-yl]-2-sulfanylbenzamide.
| Compound Name | N-[1-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]piperidin-4-yl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 108554700 |
| Molecular Formula | C22H25ClN2O3S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-[1-[2-(4-chloro-3,5-dimethylphenoxy)acetyl]piperidin-4-yl]-2-sulfanylbenzamide |
| SMILES | Cc1cc(OCC(=O)N2CCC(NC(=O)c3ccccc3S)CC2)cc(C)c1Cl |
| InChI | InChI=1S/C22H25ClN2O3S/c1-14-11-17(12-15(2)21(14)23)28-13-20(26)25-9-7-16(8-10-25)24-22(27)18-5-3-4-6-19(18)29/h3-6,11-12,16,29H,7-10,13H2,1-2H3,(H,24,27) |
| InChIKey | ZSIDMVHXXDMZEF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|