C23H25ClN4O3 — CID 108541227
N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide (PubChem CID 108541227) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide.
| Compound Name | N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 108541227 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-[2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide |
| SMILES | Cc1cc(OCC(=O)NCCNC(=O)c2ccc3nc(C)c(C)nc3c2)cc(C)c1Cl |
| InChI | InChI=1S/C23H25ClN4O3/c1-13-9-18(10-14(2)22(13)24)31-12-21(29)25-7-8-26-23(30)17-5-6-19-20(11-17)28-16(4)15(3)27-19/h5-6,9-11H,7-8,12H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | CCNDYAGYBXMETB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|