C22H23ClN4O2 — CID 108542124
N-[2-[3-(4-chlorophenyl)propanoylamino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide (PubChem CID 108542124) has the molecular formula C22H23ClN4O2 and a molecular weight of 410.91 g/mol. Its IUPAC name is N-[2-[3-(4-chlorophenyl)propanoylamino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide.
| Compound Name | N-[2-[3-(4-chlorophenyl)propanoylamino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 108542124 |
| Molecular Formula | C22H23ClN4O2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[2-[3-(4-chlorophenyl)propanoylamino]ethyl]-2,3-dimethylquinoxaline-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NCCNC(=O)CCc3ccc(Cl)cc3)cc2nc1C |
| InChI | InChI=1S/C22H23ClN4O2/c1-14-15(2)27-20-13-17(6-9-19(20)26-14)22(29)25-12-11-24-21(28)10-5-16-3-7-18(23)8-4-16/h3-4,6-9,13H,5,10-12H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | RZEXWGQIIIIZNK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|