C18H18ClN3O — CID 110765810
N-[2-(4-chlorophenyl)ethyl]-1,2-dimethylbenzimidazole-5-carboxamide (PubChem CID 110765810) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-1,2-dimethylbenzimidazole-5-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-1,2-dimethylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 110765810 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-1,2-dimethylbenzimidazole-5-carboxamide |
| SMILES | Cc1nc2cc(C(=O)NCCc3ccc(Cl)cc3)ccc2n1C |
| InChI | InChI=1S/C18H18ClN3O/c1-12-21-16-11-14(5-8-17(16)22(12)2)18(23)20-10-9-13-3-6-15(19)7-4-13/h3-8,11H,9-10H2,1-2H3,(H,20,23) |
| InChIKey | OPSURHCCDLELBQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |