C11H11ClN2O — CID 39104493
2-chloro-1-(1,2-dimethylbenzimidazol-5-yl)ethanone (PubChem CID 39104493) has the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. Its IUPAC name is 2-chloro-1-(1,2-dimethylbenzimidazol-5-yl)ethanone.
| Compound Name | 2-chloro-1-(1,2-dimethylbenzimidazol-5-yl)ethanone |
|---|---|
| PubChem CID | 39104493 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-chloro-1-(1,2-dimethylbenzimidazol-5-yl)ethanone |
| SMILES | Cc1nc2cc(C(=O)CCl)ccc2n1C |
| InChI | InChI=1S/C11H11ClN2O/c1-7-13-9-5-8(11(15)6-12)3-4-10(9)14(7)2/h3-5H,6H2,1-2H3 |
| InChIKey | IHPUOFPZKQLIAF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|