About 1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate
1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate (PubChem CID 75521574) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate.
Analyze 1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate?
The IUPAC name of 1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate (CID 75521574) is 1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate.
What is the SMILES notation for 1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate?
The canonical SMILES for 1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate is COCC(C)OC(=O)c1ccc2c(c1)nc(C)n2C.
What is the InChIKey of 1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate?
The InChIKey is JHJZCXDRCYXIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-9(8-18-4)19-14(17)11-5-6-13-12(7-11)15-10(2)16(13)3/h5-7,9H,8H2,1-4H3.
What are the key properties of 1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate?
1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate has a molecular weight of 262.31 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 1,2-dimethylbenzimidazole-5-carboxylate is sourced from PubChem (CID 75521574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).